O=C(NCC1=CC=CS1)C(=S)N1CCOCC1

InChIKey=SAUNRTCDVPXBAC-UHFFFAOYSA-N

C11H14N2O2S2

270.37

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Morpholines Thiophenes Thioamides Heteroaromatic compounds Secondary carboxylic acid amides Thiocarboxylic acid amides Oxacyclic compounds Dialkyl ethers Azacyclic compounds Thiocarbonyl compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Alpha-amino acid or derivatives - Morpholine - Oxazinane - Thioamide - Thiophene - Heteroaromatic compound - Carboxamide group - Secondary carboxylic acid amide - Azacycle - Organoheterocyclic compound - Oxacycle - Thiocarboxylic acid amide - Dialkyl ether - Ether - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic oxide - Organic nitrogen compound - Thiocarbonyl group - Carbonyl group - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available