OC1=CC=C(C=C1)C(=O)OC(=O)C1=CC(=CC=C1)C(=O)OC(=O)C1=CC=C(O)C=C1

InChIKey=RYWGDMOQKICWSU-UHFFFAOYSA-N

C22H14O8

406.346

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Phthalic acid and derivatives

M-phthalic acid and derivatives

Benzyloxycarbonyls Benzoyl derivatives 1-hydroxy-2-unsubstituted benzenoids Carboxylic acid anhydrides Organooxygen compounds Organic oxides Hydrocarbon derivatives

Aromatic homomonocyclic compounds

Meta_phthalic_acid - Benzyloxycarbonyl - Benzoyl - 1-hydroxy-2-unsubstituted benzenoid - Phenol - Carboxylic acid anhydride - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as m-phthalic acid and derivatives. These are aromatic compounds containing a benzene ring bearing a carboxylic acid group at ring carbon atoms 1 and 2.

Not available