OC(=O)CCCNS(=O)(=O)C1=CC=C(C=C1)S(=O)(=O)NCCCC(O)=O

InChIKey=RYMINRSBEGEJAD-UHFFFAOYSA-N

C14H20N2O8S2

408.44

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Gamma amino acids and derivatives

Benzenesulfonamides Benzenesulfonyl compounds Organosulfonamides Dicarboxylic acids and derivatives Aminosulfonyl compounds Carboxylic acids Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Gamma amino acid or derivatives - Benzenesulfonamide - Benzenesulfonyl group - Monocyclic benzene moiety - Dicarboxylic acid or derivatives - Organosulfonic acid amide - Benzenoid - Sulfonyl - Organosulfonic acid or derivatives - Organic sulfonic acid or derivatives - Aminosulfonyl compound - Carboxylic acid - Organic nitrogen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Carbonyl group - Hydrocarbon derivative - Organic oxide - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as gamma amino acids and derivatives. These are amino acids having a (-NH2) group attached to the gamma carbon atom.

Not available