CC(=O)NC(CCC1=CC=CC=C1)C(S)=O

InChIKey=RXPARKVGNLJQMF-UHFFFAOYSA-N

C12H15NO2S

237.32

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives - Alpha amino acids and derivatives

N-acyl-alpha amino acids and derivatives

Benzene and substituted derivatives Acetamides Secondary carboxylic acid amides Carbothioic S-acids Carbodithioic acids Thiocarboxylic acids and derivatives Alkylthiols Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

N-acyl-alpha amino acid or derivatives - Monocyclic benzene moiety - Benzenoid - Acetamide - Carbodithioic acid - Carbothioic s-acid - Secondary carboxylic acid amide - Carboxamide group - Alkylthiol - Thiocarboxylic acid or derivatives - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Organosulfur compound - Hydrocarbon derivative - Carbonyl group - Organic oxide - Organic oxygen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as n-acyl-alpha amino acids and derivatives. These are compounds containing an alpha amino acid (or a derivative thereof) which bears an acyl group at its terminal nitrogen atom.

Not available