COP(=O)(CC(=O)C1=COC=C1)OC

InChIKey=RSCOWZPVTHSCTQ-UHFFFAOYSA-N

C8H11O5P

218.145

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

Dialkyl alkylphosphonates Phosphonic acid esters Heteroaromatic compounds Furans Oxacyclic compounds Organophosphorus compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Aryl alkyl ketone - Dialkyl alkylphosphonate - Phosphonic acid diester - Phosphonic acid ester - Heteroaromatic compound - Organophosphonic acid derivative - Furan - Oxacycle - Organoheterocyclic compound - Organic oxide - Hydrocarbon derivative - Organophosphorus compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available