CCOC(=O)C(=O)C1=C(C)NC(C)=C1C(=O)OCC

InChIKey=RNQQBMRVQDIQDP-UHFFFAOYSA-N

C13H17NO5

267.281

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones

Aryl ketones

Pyrrole carboxylic acids and derivatives Substituted pyrroles Dicarboxylic acids and derivatives Alpha-keto acids and derivatives Vinylogous amides Heteroaromatic compounds Carboxylic acid esters Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Pyrrole-3-carboxylic acid or derivatives - Aryl ketone - Alpha-keto acid - Dicarboxylic acid or derivatives - Keto acid - Substituted pyrrole - Vinylogous amide - Pyrrole - Heteroaromatic compound - Carboxylic acid ester - Organoheterocyclic compound - Carboxylic acid derivative - Azacycle - Organopnictogen compound - Organic nitrogen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl ketones. These are organic aromatic compounds that contain a ketone group substituted at one C-atom with an aryl group. They have the generic structure RC(=O)R', where R = aryl group and R'=organyl group.

Not available