CCOP(=O)(OCC)C(=C(/NC(=O)C1=CC=CC=C1)C(=O)NCC1=CC=CC=C1)\C1=CC=CC=C1

InChIKey=RNLNEPIZOOUBIO-IZHYLOQSSA-N

C27H29N2O5P

492.512

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Benzamides

Hippuric acids and derivatives

N-acyl-alpha amino acids and derivatives Cinnamic acid amides Alpha amino acid amides Benzoyl derivatives Phosphonic acid diesters Phosphonic acid esters Secondary carboxylic acid amides Organophosphorus compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Hippuric acid or derivatives - N-acyl-alpha amino acid or derivatives - Alpha-amino acid amide - Cinnamic acid amide - Cinnamic acid or derivatives - Alpha-amino acid or derivatives - Benzoyl - Phosphonic acid diester - Phosphonic acid ester - Organophosphonic acid derivative - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid derivative - Organophosphorus compound - Organic oxygen compound - Hydrocarbon derivative - Organic nitrogen compound - Carbonyl group - Organic oxide - Organooxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as hippuric acids and derivatives. These are compounds containing a hippuric acid or a derivative, with a structure characterized the presence of a benzoyl group linked to the N-terminal of a glycine.

Not available