COC(=O)CNC(=O)C1CCCN1C(=O)OC(C)(C)C

InChIKey=RNCFSKLCUPXAEU-UHFFFAOYSA-N

C13H22N2O5

286.328

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Not available

Peptides

Proline and derivatives Alpha amino acid esters N-acyl-alpha amino acids and derivatives Alpha amino acid amides Pyrrolidinecarboxamides Pyrrolidine carboxylic acids Methyl esters Carbamate esters Secondary carboxylic acid amides Organic carbonic acids and derivatives Azacyclic compounds Monocarboxylic acids and derivatives Carbonyl compounds Hydrocarbon derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds

Aliphatic heteromonocyclic compounds

Alpha peptide - Alpha-amino acid ester - Proline or derivatives - N-acyl-alpha amino acid or derivatives - Alpha-amino acid amide - Alpha-amino acid or derivatives - Pyrrolidine-2-carboxamide - Pyrrolidine carboxylic acid or derivatives - Pyrrolidine carboxylic acid - Methyl ester - Carbamic acid ester - Pyrrolidine - Carboxamide group - Carboxylic acid ester - Carbonic acid derivative - Secondary carboxylic acid amide - Monocarboxylic acid or derivatives - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Carbonyl group - Organopnictogen compound - Organic oxygen compound - Organonitrogen compound - Organooxygen compound - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as peptides. These are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another.

Not available