CC(C)CN(C1CCS(=O)(=O)C1)C(=O)COC(=O)C1=CC2=C(CCC2)S1

InChIKey=RDUQAOLDJRZPCF-UHFFFAOYSA-N

C18H25NO5S2

399.52

Organic compounds

Organoheterocyclic compounds

Thiophenes

Thiophene carboxylic acids and derivatives

Not available

Thiophene carboxylic acids and derivatives

2,3,5-trisubstituted thiophenes Thiolanes Tertiary carboxylic acid amides Sulfones Heteroaromatic compounds Carboxylic acid esters Monocarboxylic acids and derivatives Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteropolycyclic compounds

Thiophene carboxylic acid or derivatives - 2,3,5-trisubstituted thiophene - Sulfone - Tertiary carboxylic acid amide - Thiolane - Heteroaromatic compound - Carboxamide group - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic nitrogen compound - Carbonyl group - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as thiophene carboxylic acids and derivatives. These are compounds containing a thiophene ring which bears a carboxylic acid group (or a salt/ester thereof).

Not available