C\C(=N/NC1=NC2=CC=CC=C2S1)C1=CC=C(O1)C1=CC(=CC(=C1)C(O)=O)C(O)=O

InChIKey=QVOOHFQRBQONRK-FOKLQQMPSA-N

C21H15N3O5S

421.43

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Phthalic acid and derivatives

M-phthalic acid and derivatives

Benzothiazoles Benzoic acids Benzoyl derivatives Thiazoles Heteroaromatic compounds Furans Oxacyclic compounds Hydrazones Carboxylic acids Azacyclic compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteropolycyclic compounds

Meta_phthalic_acid - Benzoic acid - 1,3-benzothiazole - Benzoyl - Azole - Heteroaromatic compound - Furan - Thiazole - Carboxylic acid derivative - Carboxylic acid - Oxacycle - Hydrazone - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organonitrogen compound - Organooxygen compound - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as m-phthalic acid and derivatives. These are aromatic compounds containing a benzene ring bearing a carboxylic acid group at ring carbon atoms 1 and 2.

Not available