CCCCC(C)SP(=S)(N(C)C(=O)C(=O)OCCN(C)C)N(C)S(=O)(=O)C1CC1

InChIKey=QVDVMPMMHBIMOQ-UHFFFAOYSA-N

C17H34N3O5PS3

487.63

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Organosulfonic acids and derivatives Aminosulfonyl compounds Trialkylamines Carboxylic acid esters Sulfenyl compounds Organothiophosphorus compounds Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic homomonocyclic compounds

Alpha-amino acid or derivatives - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Sulfonyl - Aminosulfonyl compound - Tertiary aliphatic amine - Tertiary amine - Carboxylic acid ester - Organothiophosphorus compound - Monocarboxylic acid or derivatives - Sulfenyl compound - Carbonyl group - Amine - Organic nitrogen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Aliphatic homomonocyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available