CC(=O)OCC1OC(C(OC(C)=O)C1OC(C)=O)N1N=CC(=O)NC1=O

InChIKey=QQOBRRFOVWGIMD-UHFFFAOYSA-N

C14H17N3O9

371.302

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbohydrates and carbohydrate conjugates

Glycosyl compounds

Glycosylamines

Tricarboxylic acids and derivatives Monosaccharides 1,2,4-triazines Tetrahydrofurans Heteroaromatic compounds Lactams Carboxylic acid esters Oxacyclic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

N-glycosyl compound - Tricarboxylic acid or derivatives - Monosaccharide - Triazine - 1,2,4-triazine - Tetrahydrofuran - Heteroaromatic compound - Lactam - Carboxylic acid ester - Organoheterocyclic compound - Carboxylic acid derivative - Azacycle - Oxacycle - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organonitrogen compound - Organopnictogen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as glycosylamines. These are compounds consisting of an amine with a beta-N-glycosidic bond to a carbohydrate, thus forming a cyclic hemiaminal ether bond (alpha-amino ether).

Not available