CC(=O)OCCN(CCOC(C)=O)C(=O)CN1C=CN=C1[N+]([O-])=O

InChIKey=QOZCPPSJSOBKQX-UHFFFAOYSA-N

C13H18N4O7

342.308

Organic compounds

Organic 1,3-dipolar compounds

Allyl-type 1,3-dipolar organic compounds

Organic nitro compounds

C-nitro compounds

Nitroaromatic compounds

N-substituted imidazoles Dicarboxylic acids and derivatives Tertiary carboxylic acid amides Heteroaromatic compounds Carboxylic acid esters Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Nitroaromatic compound - Dicarboxylic acid or derivatives - N-substituted imidazole - Azole - Imidazole - Tertiary carboxylic acid amide - Heteroaromatic compound - Carboxamide group - Carboxylic acid ester - Propargyl-type 1,3-dipolar organic compound - Organic oxoazanium - Carboxylic acid derivative - Organoheterocyclic compound - Azacycle - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Carbonyl group - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as nitroaromatic compounds. These are c-nitro compounds where the nitro group is C-substituted with an aromatic group.

Not available