O=C(NC1CC1)C(NC(=O)C1=CC=CC=C1)=CC1=CC=C(O1)SC(=S)N1CCCCC1

InChIKey=QNCAQWHPVRNKIZ-UHFFFAOYSA-N

C23H25N3O3S2

455.59

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Benzamides

Hippuric acids and derivatives

N-acyl-alpha amino acids and derivatives Alpha amino acid amides Aryl thioethers Benzoyl derivatives Piperidines Heteroaromatic compounds Furans Dithiocarbamic acid esters Secondary carboxylic acid amides Sulfenyl compounds Oxacyclic compounds Azacyclic compounds Carbonyl compounds Hydrocarbon derivatives Organic oxides Organonitrogen compounds

Aromatic heteromonocyclic compounds

Hippuric acid or derivatives - N-acyl-alpha amino acid or derivatives - Alpha-amino acid amide - Alpha-amino acid or derivatives - Aryl thioether - Benzoyl - Piperidine - Heteroaromatic compound - Furan - Dithiocarbamic acid ester - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid derivative - Oxacycle - Azacycle - Organoheterocyclic compound - Sulfenyl compound - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organonitrogen compound - Organooxygen compound - Organosulfur compound - Carbonyl group - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as hippuric acids and derivatives. These are compounds containing a hippuric acid or a derivative, with a structure characterized the presence of a benzoyl group linked to the N-terminal of a glycine.

Not available