CC(=O)OC1=CC=CC(=C1)C(=O)NC1=CC(=CC(=C1)C(O)=O)C(O)=O

InChIKey=QHDYURDPTRZPQX-UHFFFAOYSA-N

C17H13NO7

343.291

Organic compounds

Benzenoids

Benzene and substituted derivatives

Anilides

Aromatic anilides

Benzanilides

M-phthalic acid and derivatives Phenol esters Tricarboxylic acids and derivatives Benzoic acids Benzamides Phenoxy compounds Benzoyl derivatives Secondary carboxylic acid amides Carboxylic acid esters Carboxylic acids Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Benzanilide - Meta_phthalic_acid - Phenol ester - Benzamide - Benzoic acid or derivatives - Benzoic acid - Tricarboxylic acid or derivatives - Phenoxy compound - Benzoyl - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid ester - Carboxylic acid derivative - Carboxylic acid - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Carbonyl group - Organic oxide - Organopnictogen compound - Organic oxygen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as benzanilides. These are aromatic compounds containing an anilide group in which the carboxamide group is substituted with a benzene ring. They have the general structure RNC(=O)R', where R,R'= benzene.

Not available