O=C(OC1=CC=CC=C1C(=O)NC1=CC=CC=C1)C1=CC=CS1

InChIKey=QFLLJCWFLUCTLM-UHFFFAOYSA-N

C18H13NO3S

323.37

Organic compounds

Benzenoids

Benzene and substituted derivatives

Anilides

Aromatic anilides

Benzanilides

Phenol esters Benzamides Thiophene carboxylic acids and derivatives Phenoxy compounds Benzoyl derivatives Heteroaromatic compounds Secondary carboxylic acid amides Carboxylic acid esters Monocarboxylic acids and derivatives Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Benzanilide - Phenol ester - Benzamide - Benzoic acid or derivatives - Phenoxy compound - Benzoyl - Thiophene carboxylic acid or derivatives - Heteroaromatic compound - Thiophene - Carboxamide group - Carboxylic acid ester - Secondary carboxylic acid amide - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organoheterocyclic compound - Organic oxide - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Organopnictogen compound - Organic oxygen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as benzanilides. These are aromatic compounds containing an anilide group in which the carboxamide group is substituted with a benzene ring. They have the general structure RNC(=O)R', where R,R'= benzene.

Not available