O[C@@H]1[C@H]2OP(=O)(N(CC3=CC=CC=C3)[C@@H]2CC2=CC=CC=C2)N(CC2=CC=CC=C2)[C@@H]1CC1=CC=CC=C1

InChIKey=QFLHUCSEJNNYPI-MDVOKYIUSA-N

C32H33N2O3P

524.601

Organic compounds

Organic acids and derivatives

Organic phosphoric acids and derivatives

Organic phosphoramides

Organic phosphoric acid diamides

Phosphoric monoester diamides

Oxazaphosphinanes Benzene and substituted derivatives Secondary alcohols Oxacyclic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteropolycyclic compounds

Phosphoric monoester diamide - Monocyclic benzene moiety - Oxazaphosphinane - Benzenoid - Secondary alcohol - Oxacycle - Azacycle - Organoheterocyclic compound - Alcohol - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as phosphoric monoester diamides. These are organophosphorus compounds containing a monoamide derivative of a phosphoric acid diester functional group. They have the general structure R1OP(=O)(N(R2)R3)N(R4)R5, where R1 = organyl group and R2-R5 = H or organyl.

Not available