CC1(C=CC2(CCCCC2)N1C(=O)C1=CC=CC=C1)C(=O)NCC1CC1

InChIKey=QFAWJSWNBLXVGD-UHFFFAOYSA-N

C22H28N2O2

352.478

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Benzamides Pyrroline carboxylic acids and derivatives Benzoyl derivatives Tertiary carboxylic acid amides Secondary carboxylic acid amides Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteropolycyclic compounds

Alpha-amino acid or derivatives - Benzamide - Benzoic acid or derivatives - Benzoyl - Pyrroline carboxylic acid or derivatives - Benzenoid - Monocyclic benzene moiety - Tertiary carboxylic acid amide - Pyrroline - Secondary carboxylic acid amide - Carboxamide group - Organoheterocyclic compound - Azacycle - Organooxygen compound - Organonitrogen compound - Carbonyl group - Organic nitrogen compound - Organic oxide - Organic oxygen compound - Hydrocarbon derivative - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available