O=C1CCC(=O)N1CSC(=S)N\N=C/C1=CC=CO1

InChIKey=QCHHLLICTSPYNW-SDQBBNPISA-N

C11H11N3O3S2

297.35

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid imides

N-substituted carboxylic acid imides

Pyrrolidine-2-ones N-alkylpyrrolidines Heteroaromatic compounds Furans Dicarboximides Lactams Thiohemiaminal derivatives Sulfenyl compounds Oxacyclic compounds Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Carboxylic acid imide, n-substituted - Pyrrolidone - 2-pyrrolidone - N-alkylpyrrolidine - Heteroaromatic compound - Pyrrolidine - Dicarboximide - Furan - Lactam - Sulfenyl compound - Hemithioaminal - Azacycle - Oxacycle - Organoheterocyclic compound - Carbonyl group - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as n-substituted carboxylic acid imides. These are compounds comprising an N-substituted carboxylic acid imide group, with the general structure R1N(C(R2)=O)C(R3)=O (R2,R3=H, alkyl, aryl; R1=Anything but H).

Not available