CC(C)CN(CC(=O)N(CC(C)C)NC(N)=O)NC(=O)OC(C)(C)C

InChIKey=PXJHEJHSMJRIFB-UHFFFAOYSA-N

C16H33N5O4

359.471

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Semicarbazides Carboxylic acid hydrazides Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic acyclic compounds

Alpha-amino acid or derivatives - Semicarbazide - Carboxylic acid hydrazide - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available