CS(=O)(=O)N1N=C(C[C@@H]1C1=CC=CO1)C1CC1

InChIKey=PPGCZWLZKIMJMQ-SNVBAGLBSA-N

C11H14N2O3S

254.3

Organic compounds

Organic nitrogen compounds

Organonitrogen compounds

Hydrazines and derivatives

Hydrazones

N-alkyl sulfonyl hydrazones

Sulfonyls Pyrazolines Organosulfonic acids and derivatives Heteroaromatic compounds Furans N-alkylated hydrazones Oxacyclic compounds Azacyclic compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

N-alkyl sulfonyl hydrazone - Furan - Pyrazoline - Organic sulfonic acid or derivatives - Heteroaromatic compound - Organosulfonic acid or derivatives - Sulfonyl - N-alkylated hydrazone - Azacycle - Oxacycle - Organoheterocyclic compound - Hydrocarbon derivative - Organic oxide - Organosulfur compound - Organooxygen compound - Organic oxygen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as n-alkyl sulfonyl hydrazones. These are organonitrogen compounds containing a hydrazone derivative with the generic structure R1C(R2)=NN(R4)S(R3)(=O)=O where R4 = alkyl group and R1-R3 = H or organyl group.

Not available