CC(=O)OC(C(C)=O)C(=O)C1=CC=CS1

InChIKey=PEIZMULJVKUVFR-UHFFFAOYSA-N

C10H10O4S

226.25

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

Beta-diketones Alpha-acyloxy ketones Thiophenes Heteroaromatic compounds Carboxylic acid esters Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Aryl alkyl ketone - 1,3-diketone - Alpha-acyloxy ketone - 1,3-dicarbonyl compound - Heteroaromatic compound - Thiophene - Carboxylic acid ester - Organoheterocyclic compound - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxide - Hydrocarbon derivative - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available