C=CC(=O)N[C@]12C[C@H]3C[C@H](C[C@H](C3)C1)C2

InChIKey=PBTMWGMSOKDCRP-DNSLJTBWSA-N

C13H19NO

205.301

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Not available

Carboxylic acid amides

Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aliphatic homopolycyclic compounds

Carboxamide group - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aliphatic homopolycyclic compound

This compound belongs to the class of organic compounds known as carboxylic acid amides. These are carboxylic acid derivatives containing a carbonyl group in which the carbon atom is linked to a nitrogen atom (substituted or not). The general formula of the carboxylic acid amide is R1C(=O)N(R2)R3 (R1,R2,R3=H, alkyl, aryl).

Not available