CCCCOP(=O)(COP(=O)(OCCC)OCCC)OCCCC

InChIKey=OWUPOQAFHDQPQU-UHFFFAOYSA-N

C15H34O7P2

388.378

Organic compounds

Organic acids and derivatives

Organic phosphoric acids and derivatives

Phosphate esters

Alkyl phosphates

Trialkyl phosphates

Dialkyl alkylphosphonates Phosphonic acid esters Organopnictogen compounds Organophosphorus compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives

Aliphatic acyclic compounds

Trialkyl phosphate - Dialkyl alkylphosphonate - Phosphonic acid diester - Phosphonic acid ester - Organophosphonic acid derivative - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organophosphorus compound - Organooxygen compound - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as trialkyl phosphates. These are organic compounds containing a phosphate group that is linked to exactly three alkyl chains.

Not available