OC(=O)C1=CC(NC(=O)C2=CC=CC=C2NC(=O)C=CC2=CC=CO2)=CC=C1

InChIKey=OTYWQKLBAFKSLO-UHFFFAOYSA-N

C21H16N2O5

376.368

Organic compounds

Benzenoids

Benzene and substituted derivatives

Anilides

Aromatic anilides

Benzanilides

Acylaminobenzoic acid and derivatives Benzamides Benzoic acids N-arylamides Benzoyl derivatives Vinylogous amides Heteroaromatic compounds Furans Secondary carboxylic acid amides Oxacyclic compounds Monocarboxylic acids and derivatives Carboxylic acids Carbonyl compounds Hydrocarbon derivatives Organic oxides Organopnictogen compounds

Aromatic heteromonocyclic compounds

Benzanilide - Acylaminobenzoic acid or derivatives - Benzamide - Benzoic acid or derivatives - Benzoic acid - Benzoyl - N-arylamide - Furan - Heteroaromatic compound - Vinylogous amide - Carboxamide group - Secondary carboxylic acid amide - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Oxacycle - Organoheterocyclic compound - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Carbonyl group - Organic oxide - Organopnictogen compound - Organic oxygen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as benzanilides. These are aromatic compounds containing an anilide group in which the carboxamide group is substituted with a benzene ring. They have the general structure RNC(=O)R', where R,R'= benzene.

Not available