O=C(NNC1=CC=CC=C1)C(\NC(=O)C1=CC=CC=C1)=C/C1=CC2=C(OCO2)C=C1

InChIKey=OSEPBJOMVJGXKO-CPNJWEJPSA-N

C23H19N3O4

401.422

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Benzamides

Hippuric acids and derivatives

N-acyl-alpha amino acids and derivatives Cinnamic acids and derivatives Benzodioxoles Phenylhydrazines Benzoyl derivatives Secondary carboxylic acid amides Carboxylic acid hydrazides Oxacyclic compounds Acetals Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteropolycyclic compounds

Hippuric acid or derivatives - N-acyl-alpha amino acid or derivatives - Cinnamic acid or derivatives - Alpha-amino acid or derivatives - Benzodioxole - Benzoyl - Phenylhydrazine - Carboxamide group - Carboxylic acid hydrazide - Secondary carboxylic acid amide - Acetal - Carboxylic acid derivative - Oxacycle - Organoheterocyclic compound - Hydrocarbon derivative - Organic nitrogen compound - Organic oxide - Carbonyl group - Organopnictogen compound - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as hippuric acids and derivatives. These are compounds containing a hippuric acid or a derivative, with a structure characterized the presence of a benzoyl group linked to the N-terminal of a glycine.

Not available