NC(=O)CNC(=O)C1=CC=CC=C1SC(=O)C1=CC=NC=C1

InChIKey=OPNYLNZJLRXHHY-UHFFFAOYSA-N

C15H13N3O3S

315.35

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Benzamides

Hippuric acids and derivatives

N-acyl-alpha amino acids and derivatives O-sulfanylbenzoic acids and derivatives Pyridinecarboxylic acids and derivatives Aryl thioethers Benzoyl derivatives Heteroaromatic compounds Primary carboxylic acid amides Thioesters Carbothioic S-esters Secondary carboxylic acid amides Sulfenyl compounds Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Hippuric acid or derivatives - N-acyl-alpha amino acid or derivatives - N-substituted-alpha-amino acid - Alpha-amino acid or derivatives - O-sulfanylbenzoic acid or derivatives - Pyridine carboxylic acid or derivatives - Aryl thioether - Benzoyl - Pyridine - Heteroaromatic compound - Carbothioic s-ester - Carboxamide group - Primary carboxylic acid amide - Secondary carboxylic acid amide - Thiocarboxylic acid ester - Carboxylic acid derivative - Organoheterocyclic compound - Sulfenyl compound - Azacycle - Thiocarboxylic acid or derivatives - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Carbonyl group - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as hippuric acids and derivatives. These are compounds containing a hippuric acid or a derivative, with a structure characterized the presence of a benzoyl group linked to the N-terminal of a glycine.

Not available