CCOC(=O)C1=S(=O)(C2=CC=CC=C2C1=O)C1=CC=CC=C1

InChIKey=OLNMVOJXFWFKRO-UHFFFAOYSA-N

C17H14O4S

314.36

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones

Aryl ketones

Benzene and substituted derivatives Thioketone s-oxides Carboxylic acid esters Organoheterocyclic compounds Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives

Aromatic heteropolycyclic compounds

Aryl ketone - Benzenoid - Monocyclic benzene moiety - Thioketone-s-oxide - Thioketone - Carboxylic acid ester - Organoheterocyclic compound - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as aryl ketones. These are organic aromatic compounds that contain a ketone group substituted at one C-atom with an aryl group. They have the generic structure RC(=O)R', where R = aryl group and R'=organyl group.

Not available