CO\C(N)=N\S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F

InChIKey=OJQUGMBSNQHMNB-UHFFFAOYSA-N

C10H5F17N2O3S

556.19

Organic compounds

Organohalogen compounds

Alkyl halides

Alkyl fluorides

Perfluoroalkyl sulfonic acid and derivatives

Perfluorooctane sulfonic acid and derivatives

Sulfonylureas Sulfonyls Organosulfonic acids and derivatives Organooxygen compounds Organofluorides Organic oxides Hydrocarbon derivatives

Aliphatic acyclic compounds

Perfluorooctane sulfonic acid or derivatives - Sulfonylurea - Sulfonyl - Organosulfonic acid or derivatives - Organic sulfonic acid or derivatives - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as perfluorooctane sulfonic acid and derivatives. These are organic compounds containing an octyl chain attached to the sulfur of a sulfonic acid (or a derivative thereof), where all hydrogens of the octyl chain are replaced by fluorine atoms.

Not available