CCO\N=C\C1=C(N2[C@@H]([C@@H](NC(=O)CC3=CC=CS3)C2=O)[S@](=O)C1)C(O)=O

InChIKey=OJGPZWNNUQJTMT-LKBQWFKFSA-N

C16H17N3O6S2

411.45

Organic compounds

Organoheterocyclic compounds

Lactams

Beta lactams

Cephems

Cephalosporins

N-acyl-alpha amino acids and derivatives 1,3-thiazines Thiophenes Tertiary carboxylic acid amides Heteroaromatic compounds Sulfoxides Secondary carboxylic acid amides Oxime ethers Azetidines Sulfinyl compounds Azacyclic compounds Carboxylic acids Monocarboxylic acids and derivatives Organic oxides Carbonyl compounds Hydrocarbon derivatives

Aromatic heteropolycyclic compounds

Cephalosporin - N-acyl-alpha amino acid or derivatives - Alpha-amino acid or derivatives - Meta-thiazine - Heteroaromatic compound - Thiophene - Tertiary carboxylic acid amide - Azetidine - Carboxamide group - Sulfoxide - Secondary carboxylic acid amide - Oxime ether - Carboxylic acid derivative - Carboxylic acid - Azacycle - Monocarboxylic acid or derivatives - Sulfinyl compound - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Carbonyl group - Organonitrogen compound - Organooxygen compound - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as cephalosporins. These are compounds containing a 1,2-thiazine fused to a 2-azetidinone to for a oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid moiety or a derivative thereof.

Not available