CC(C)C(=O)C1=NC(Cl)=CC=C1

InChIKey=OHCDRCBWAVYBQF-UHFFFAOYSA-N

C9H10ClNO

183.64

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

2-halopyridines Aryl chlorides Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Aryl alkyl ketone - 2-halopyridine - Aryl chloride - Aryl halide - Pyridine - Heteroaromatic compound - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organonitrogen compound - Organochloride - Organohalogen compound - Organopnictogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available