C[C@H](OS(O)(=O)=O)[C@H]1[C@H]2CC(=C(N2C1=O)C(O)=O)S(=O)CCNC(C)=O

InChIKey=ODUQOQWOWRYNEC-GZTGQLOYSA-N

C13H18N2O9S2

410.41

Organic compounds

Organoheterocyclic compounds

Lactams

Beta lactams

Carbapenems

Thienamycins

Alpha amino acids and derivatives Pyrroline carboxylic acids Azepines Sulfuric acid monoesters Alkyl sulfates Acetamides Tertiary carboxylic acid amides Secondary carboxylic acid amides Azetidines Sulfoxides Sulfinyl compounds Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic heteropolycyclic compounds

Thienamycin - Alpha-amino acid or derivatives - Pyrroline carboxylic acid - Pyrroline carboxylic acid or derivatives - Azepine - Sulfuric acid ester - Alkyl sulfate - Sulfuric acid monoester - Sulfate-ester - Organic sulfuric acid or derivatives - Pyrroline - Acetamide - Tertiary carboxylic acid amide - Azetidine - Carboxamide group - Secondary carboxylic acid amide - Sulfoxide - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Azacycle - Sulfinyl compound - Hydrocarbon derivative - Organic oxide - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organopnictogen compound - Organic nitrogen compound - Carbonyl group - Organic oxygen compound - Aliphatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as thienamycins. These are beta-lactam antibiotics that differ from penicillins in having the thiazolidine sulfur atom replaced by carbon, the sulfur then becoming the first atom in the side chain.

Not available