CCCCCCCC\C=C/CCCCCCCCN(CCCCCCCC\C=C/CCCCCCCC)C(=O)CCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C

InChIKey=OCDDRBXUHFAYFL-YPAXQUSRSA-N

C50H94N4O5

831.325

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid amides

Tertiary carboxylic acid amides

Carbamate esters Guanidines Propargyl-type 1,3-dipolar organic compounds Carboximidamides Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic acyclic compounds

Carbamic acid ester - Tertiary carboxylic acid amide - Guanidine - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Carboximidamide - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as tertiary carboxylic acid amides. These are compounds containing an amide derivative of carboxylic acid, with the general structure RN(R1)C(R2)=O (R1-R2 any atom but H).

Not available