CCCC1OP(=O)(OCC1CC)N(CCOC(C)=O)CCOC(C)=O

InChIKey=OBBOKOIRFWDVHH-UHFFFAOYSA-N

C16H30NO7P

379.39

Organic compounds

Organic acids and derivatives

Organic phosphoric acids and derivatives

Phosphate esters

Not available

Phosphoric diester monoamides

Organic phosphoramides Dicarboxylic acids and derivatives Carboxylic acid esters Oxacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic heteromonocyclic compounds

Phosphoric diester monoamide - Organic phosphoric acid amide - Dicarboxylic acid or derivatives - Carboxylic acid ester - Oxacycle - Organoheterocyclic compound - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as phosphoric diester monoamides. These are organophosphorus compounds containing a monoamide derivative of a phosphoric acid diester functional group. They have the general structure R1OP(=O)(OR2)N(R3)R4, where R1-R2 = organyl group and R3-R4 = H or organyl.

Not available