CCOC(=O)C(C(CC(=O)C1=CC=CC=N1)C1=CC=CO1)C(=O)C1=CC=CC=N1

InChIKey=NPGOTQZMYXYQCL-UHFFFAOYSA-N

C22H20N2O5

392.411

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

Fatty acid esters Beta-keto acids and derivatives Pyridines and derivatives 1,3-dicarbonyl compounds Heteroaromatic compounds Furans Carboxylic acid esters Oxacyclic compounds Monocarboxylic acids and derivatives Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Aryl alkyl ketone - Beta-keto acid - Fatty acid ester - Keto acid - Pyridine - 1,3-dicarbonyl compound - Fatty acyl - Furan - Heteroaromatic compound - Carboxylic acid ester - Oxacycle - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available