N[C@@H](CC1=CN=C(Br)N1)C(O)=O

InChIKey=NLVOWJVMOQAYDW-BYPYZUCNSA-N

C6H8BrN3O2

234.053

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Imidazolyl carboxylic acids and derivatives Heteroaromatic compounds Propargyl-type 1,3-dipolar organic compounds Monocarboxylic acids and derivatives Carboxylic acids Carboximidamides Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organobromides Organic oxides Monoalkylamines Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Alpha-amino acid or derivatives - Imidazolyl carboxylic acid derivative - Heteroaromatic compound - Imidazole - Azole - Azacycle - Organoheterocyclic compound - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Carboximidamide - Monocarboxylic acid or derivatives - Carboxylic acid - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organobromide - Organohalogen compound - Primary aliphatic amine - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

CHEBI:19422 : non-proteinogenic L-alpha-amino acid - L-histidine derivative - bromoamino acid