FC(F)(F)C(F)(F)C(=O)NC(CC1=CC=CC=C1)OC(=O)C(F)(F)C(F)(F)F

InChIKey=NKWLCINSINQSRY-UHFFFAOYSA-N

C14H9F10NO3

429.214

Organic compounds

Organohalogen compounds

Alkyl halides

Alkyl fluorides

Not available

Perfluoroalkyl carboxylic acid and derivatives

Benzene and substituted derivatives Alpha-halocarboxylic acid derivatives Secondary carboxylic acid amides Carboxylic acid esters Monocarboxylic acids and derivatives Organopnictogen compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Perfluoroalkyl carboxylic acid or derivatives - Monocyclic benzene moiety - Benzenoid - Alpha-halocarboxylic acid derivative - Alpha-halocarboxylic acid or derivatives - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid ester - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Organic nitrogen compound - Organofluoride - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Carbonyl group - Organopnictogen compound - Organic oxygen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as perfluoroalkyl carboxylic acid and derivatives. These are organic compounds containing an alkyl chain attached to the C-alpha of a carboxylic acid group (or a derivative thereof), where all hydrogens of the alkyl chain are replaced by fluorine atoms.

Not available