OC(=O)CCCNC(=S)SCC1=CC=CC=C1

InChIKey=NFGAEXVHQUVGAM-UHFFFAOYSA-N

C12H15NO2S2

269.38

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Gamma amino acids and derivatives

Benzene and substituted derivatives Dithiocarbamic acid esters Sulfenyl compounds Monocarboxylic acids and derivatives Carboxylic acids Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Gamma amino acid or derivatives - Monocyclic benzene moiety - Benzenoid - Dithiocarbamic acid ester - Carboxylic acid - Monocarboxylic acid or derivatives - Sulfenyl compound - Organic nitrogen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Carbonyl group - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as gamma amino acids and derivatives. These are amino acids having a (-NH2) group attached to the gamma carbon atom.

Not available