IC1=CC=C(N1)C(=O)C1=CC=C(I)N1

InChIKey=NEPLTTWWFVXBFI-UHFFFAOYSA-N

C9H6I2N2O

411.969

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones

Aryl ketones

Substituted pyrroles Aryl iodides Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organoiodides Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Aryl ketone - Aryl halide - Aryl iodide - Substituted pyrrole - Pyrrole - Heteroaromatic compound - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organonitrogen compound - Organoiodide - Organohalogen compound - Organopnictogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl ketones. These are organic aromatic compounds that contain a ketone group substituted at one C-atom with an aryl group. They have the generic structure RC(=O)R', where R = aryl group and R'=organyl group.

Not available