C[C@H](NC(=O)C1=CC=CC=C1SC(=O)NC(C)(C)C)C(N)=O

InChIKey=NEKINZACZNEFPL-VIFPVBQESA-N

C15H21N3O3S

323.41

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Benzamides

Hippuric acids and derivatives

N-acyl-alpha amino acids and derivatives Alanine and derivatives O-sulfanylbenzoic acids and derivatives Benzoyl derivatives Aryl thioethers Thiocarbamic acid derivatives Secondary carboxylic acid amides Primary carboxylic acid amides Sulfenyl compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Hippuric acid or derivatives - N-acyl-alpha amino acid or derivatives - Alanine or derivatives - N-substituted-alpha-amino acid - Alpha-amino acid or derivatives - O-sulfanylbenzoic acid or derivatives - Aryl thioether - Benzoyl - Carboxamide group - Thiocarbamic acid derivative - Secondary carboxylic acid amide - Primary carboxylic acid amide - Carboxylic acid derivative - Sulfenyl compound - Organosulfur compound - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Carbonyl group - Organic oxide - Organooxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as hippuric acids and derivatives. These are compounds containing a hippuric acid or a derivative, with a structure characterized the presence of a benzoyl group linked to the N-terminal of a glycine.

Not available