CCCC1=NC2=C(CC(CC(C)S(=O)CC)CC2=O)O1

InChIKey=NAZWBDBUNHROBT-UHFFFAOYSA-N

C15H23NO3S

297.41

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

Oxazoles Heteroaromatic compounds Sulfoxides Sulfinyl compounds Oxacyclic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteropolycyclic compounds

Aryl alkyl ketone - Heteroaromatic compound - Oxazole - Azole - Sulfoxide - Oxacycle - Azacycle - Organoheterocyclic compound - Sulfinyl compound - Organic nitrogen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organonitrogen compound - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available