COC(OC)C(=O)CC(=O)C1=CC=NC=C1

InChIKey=MYBMDAMPJBPVRA-UHFFFAOYSA-N

C11H13NO4

223.228

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

Beta-diketones Pyridines and derivatives Heteroaromatic compounds Azacyclic compounds Acetals Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Aldehydes

Aromatic heteromonocyclic compounds

Aryl alkyl ketone - 1,3-diketone - 1,3-dicarbonyl compound - Pyridine - Heteroaromatic compound - Azacycle - Organoheterocyclic compound - Acetal - Organic nitrogen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organonitrogen compound - Aldehyde - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available