CCCCOC(=O)C(N)(C(=O)OC)P(=O)(OC)OC

InChIKey=MXRAYSKLJRQTLW-UHFFFAOYSA-N

C10H20NO7P

297.244

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Dialkyl alkylphosphonates Phosphonic acid esters Dicarboxylic acids and derivatives Methyl esters Organophosphorus compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic acyclic compounds

Alpha-amino acid or derivatives - Dialkyl alkylphosphonate - Phosphonic acid diester - Dicarboxylic acid or derivatives - Phosphonic acid ester - Organophosphonic acid derivative - Methyl ester - Carboxylic acid ester - Organic nitrogen compound - Organophosphorus compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Carbonyl group - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available