[2H]OC(=O)C1=C([2H])C(C(=O)O[2H])=C(C([2H])=C1C(=O)N([2H])C)C(=O)N([2H])CCC

InChIKey=MTGSXRCPCNBDDQ-OYEBCYSHSA-N

C14H16N2O6

314.327

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Phthalic acid and derivatives

M-phthalic acid and derivatives

Benzoic acids Benzamides Benzoyl derivatives Secondary carboxylic acid amides Carboxylic acids Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic homomonocyclic compounds

Meta_phthalic_acid - Benzoic acid - Benzamide - Benzoyl - Secondary carboxylic acid amide - Carboxamide group - Carboxylic acid - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as m-phthalic acid and derivatives. These are aromatic compounds containing a benzene ring bearing a carboxylic acid group at ring carbon atoms 1 and 2.

Not available