CCOC(=O)C(NC(=O)[C@H](C)NC(=O)OC(C)(C)C)P(=O)(OCC)OCC

InChIKey=MPLRMLXKCFPEGY-AMGKYWFPSA-N

C16H31N2O8P

410.404

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Not available

Peptides

N-acyl-alpha amino acids and derivatives Alpha amino acid esters Alpha amino acid amides Alanine and derivatives Dialkyl alkylphosphonates Phosphonic acid esters Carbamate esters Secondary carboxylic acid amides Carboxylic acid esters Monocarboxylic acids and derivatives Organophosphorus compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic acyclic compounds

Alpha peptide - Alpha-amino acid ester - N-acyl-alpha amino acid or derivatives - Alpha-amino acid amide - Alanine or derivatives - N-substituted-alpha-amino acid - Alpha-amino acid or derivatives - Dialkyl alkylphosphonate - Phosphonic acid diester - Phosphonic acid ester - Carbamic acid ester - Organophosphonic acid derivative - Carboxamide group - Carboxylic acid ester - Secondary carboxylic acid amide - Monocarboxylic acid or derivatives - Organic oxygen compound - Organic nitrogen compound - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organophosphorus compound - Organonitrogen compound - Organooxygen compound - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as peptides. These are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another.

Not available