CCC1=CC=CC=C1N1C(=S)NC(=O)C(=CC2=C(C)N(C(C)=C2)C2=CC(=CC(=C2)C(O)=O)C(O)=O)C1=O

InChIKey=MMQRSFFSKMGAMF-UHFFFAOYSA-N

C27H23N3O6S

517.56

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Phthalic acid and derivatives

M-phthalic acid and derivatives

Phenylpyrroles N-phenylthioureas Thiobarbituric acid derivatives Benzoic acids Benzoyl derivatives Diazinanes Heteroaromatic compounds Thioureas Carboxylic acids Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Meta_phthalic_acid - 1-phenylpyrrole - N-phenylthiourea - Benzoic acid - Thiobarbiturate - Benzoyl - 1,3-diazinane - Substituted pyrrole - Pyrrole - Heteroaromatic compound - Thiourea - Azacycle - Carboxylic acid - Carboxylic acid derivative - Organoheterocyclic compound - Organic nitrogen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Carbonyl group - Organic oxygen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as m-phthalic acid and derivatives. These are aromatic compounds containing a benzene ring bearing a carboxylic acid group at ring carbon atoms 1 and 2.

Not available