CCOC(=O)C1=C(C)C(CC)=C(N1)C(O)=O

InChIKey=MKNHWTOENPMOPQ-UHFFFAOYSA-N

C11H15NO4

225.244

Organic compounds

Organoheterocyclic compounds

Pyrroles

Pyrrole carboxylic acids and derivatives

Pyrrole carboxylic acids

Pyrrole 2-carboxylic acids

Substituted pyrroles Dicarboxylic acids and derivatives Heteroaromatic compounds Carboxylic acid esters Carboxylic acids Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Pyrrole-2-carboxylic acid - Dicarboxylic acid or derivatives - Substituted pyrrole - Heteroaromatic compound - Carboxylic acid ester - Azacycle - Carboxylic acid derivative - Carboxylic acid - Organic oxide - Hydrocarbon derivative - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organopnictogen compound - Organic oxygen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as pyrrole 2-carboxylic acids. These are pyrrole carboxylic acids where the carboxyl group is attached at position C2.

Not available