CC(C)(C)OOC(=O)C1=CC=C(C=C1)C(=O)OOC(C)(C)C

InChIKey=MEBDAPKZBGYVCA-UHFFFAOYSA-N

C16H22O6

310.346

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Phthalic acid and derivatives

P-phthalic acid and derivatives

Peroxybenzoic acids and derivatives Benzoyl derivatives Dicarboxylic acids and derivatives Peroxycarboxylic acids and derivatives Carboxylic acid salts Organooxygen compounds Organic salts Organic oxides Hydrocarbon derivatives

Aromatic homomonocyclic compounds

Para_phthalic_acid - Peroxybenzoate - Benzoyl - Dicarboxylic acid or derivatives - Peroxycarboxylic acid or derivatives - Carboxylic acid salt - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organic salt - Organooxygen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as p-phthalic acid and derivatives. These are compounds containing a benzene ring bearing a carboxylic acid group at ring carbon atoms 1 and 4.

Not available