CCN(CC)C(=O)C(NC(=O)C1=CC=CC=C1)=C(SC1=NC2=CC=CC=C2O1)C1=CC=CC=C1

InChIKey=MDFBKRDLKMQFSA-UHFFFAOYSA-N

C27H25N3O3S

471.58

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Benzamides

Hippuric acids and derivatives

N-acyl-alpha amino acids and derivatives Alpha amino acid amides Cinnamic acids and derivatives Benzoxazoles Aryl thioethers Benzoyl derivatives Vinylogous thioesters Heteroaromatic compounds Tertiary carboxylic acid amides Oxazoles Thioenol ethers Secondary carboxylic acid amides Oxacyclic compounds Sulfenyl compounds Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteropolycyclic compounds

Hippuric acid or derivatives - N-acyl-alpha amino acid or derivatives - Alpha-amino acid amide - Cinnamic acid or derivatives - Alpha-amino acid or derivatives - Benzoxazole - Aryl thioether - Benzoyl - Vinylogous thioester - Azole - Heteroaromatic compound - Oxazole - Tertiary carboxylic acid amide - Carboxamide group - Thioenolether - Secondary carboxylic acid amide - Sulfenyl compound - Organoheterocyclic compound - Azacycle - Carboxylic acid derivative - Oxacycle - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organosulfur compound - Organic oxygen compound - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as hippuric acids and derivatives. These are compounds containing a hippuric acid or a derivative, with a structure characterized the presence of a benzoyl group linked to the N-terminal of a glycine.

Not available