CCOP(=O)(CC(=O)NC(C(C)C)C(N)=O)OCC

InChIKey=MBZDPLXDDHXYNL-UHFFFAOYSA-N

C11H23N2O5P

294.288

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives - Alpha amino acids and derivatives

N-acyl-alpha amino acids and derivatives

Valine and derivatives Dialkyl alkylphosphonates Phosphonic acid esters Fatty amides Secondary carboxylic acid amides Primary carboxylic acid amides Organopnictogen compounds Organophosphorus compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic acyclic compounds

Valine or derivatives - N-acyl-alpha amino acid or derivatives - Dialkyl alkylphosphonate - Phosphonic acid diester - Fatty acyl - Phosphonic acid ester - Fatty amide - Organophosphonic acid derivative - Secondary carboxylic acid amide - Primary carboxylic acid amide - Carboxamide group - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organophosphorus compound - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as n-acyl-alpha amino acids and derivatives. These are compounds containing an alpha amino acid (or a derivative thereof) which bears an acyl group at its terminal nitrogen atom.

Not available